About 2-sulfonyl-1,3-dithiane
2-sulfonyl-1,3-dithiane (PubChem CID 175768464) has the molecular formula C4H6O2S3
and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-sulfonyl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-sulfonyl-1,3-dithiane |
| PubChem CID | 175768464 |
| Molecular Formula | C4H6O2S3 |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | 2-sulfonyl-1,3-dithiane |
| SMILES | O=S(=O)=C1SCCCS1 |
| InChI | InChI=1S/C4H6O2S3/c5-9(6)4-7-2-1-3-8-4/h1-3H2 |
| InChIKey | KSTJBYDIYVFFLG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonyl-1,3-dithiane?
The IUPAC name of 2-sulfonyl-1,3-dithiane (CID 175768464) is 2-sulfonyl-1,3-dithiane.
What is the SMILES notation for 2-sulfonyl-1,3-dithiane?
The canonical SMILES for 2-sulfonyl-1,3-dithiane is O=S(=O)=C1SCCCS1.
What is the InChIKey of 2-sulfonyl-1,3-dithiane?
The InChIKey is KSTJBYDIYVFFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2S3/c5-9(6)4-7-2-1-3-8-4/h1-3H2.
What are the key properties of 2-sulfonyl-1,3-dithiane?
2-sulfonyl-1,3-dithiane has a molecular weight of 182.29 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonyl-1,3-dithiane is sourced from PubChem (CID 175768464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).