C11H11ClN2O2 — CID 175768734
2'-chlorospiro[cyclopentane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione (PubChem CID 175768734) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2'-chlorospiro[cyclopentane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione.
| Compound Name | 2'-chlorospiro[cyclopentane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione |
|---|---|
| PubChem CID | 175768734 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2'-chlorospiro[cyclopentane-1,3'-imidazo[1,5-a]pyridine]-1',5'-dione |
| SMILES | O=C1c2cccc(=O)n2C2(CCCC2)N1Cl |
| InChI | InChI=1S/C11H11ClN2O2/c12-14-10(16)8-4-3-5-9(15)13(8)11(14)6-1-2-7-11/h3-5H,1-2,6-7H2 |
| InChIKey | VNIJLLWAWWBZCC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|