C34H48O3Si — CID 175768889
[2,6-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-(4-phenylmethoxy-3-propan-2-ylphenyl)methanol (PubChem CID 175768889) has the molecular formula C34H48O3Si and a molecular weight of 532.84 g/mol. Its IUPAC name is [2,6-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-(4-phenylmethoxy-3-propan-2-ylphenyl)methanol.
| Compound Name | [2,6-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-(4-phenylmethoxy-3-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 175768889 |
| Molecular Formula | C34H48O3Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | [2,6-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-(4-phenylmethoxy-3-propan-2-ylphenyl)methanol |
| SMILES | Cc1cc(O[Si](C(C)C)(C(C)C)C(C)C)cc(C)c1C(O)c1ccc(OCc2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C34H48O3Si/c1-22(2)31-20-29(16-17-32(31)36-21-28-14-12-11-13-15-28)34(35)33-26(9)18-30(19-27(33)10)37-38(23(3)4,24(5)6)25(7)8/h11-20,22-25,34-35H,21H2,1-10H3 |
| InChIKey | LCBSZYUQWNSTNM-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|