About CID 175769344
CID 175769344 (PubChem CID 175769344) has the molecular formula C9H6ClN3NaS
and a molecular weight of 246.68 g/mol.
Molecular Properties
| Compound Name | CID 175769344 |
| PubChem CID | 175769344 |
| Molecular Formula | C9H6ClN3NaS |
| Molecular Weight | 246.68 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | — |
| SMILES | Cn1nc2ccc(S)c(Cl)c2c1C#N.[Na] |
| InChI | InChI=1S/C9H6ClN3S.Na/c1-13-6(4-11)8-5(12-13)2-3-7(14)9(8)10;/h2-3,14H,1H3; |
| InChIKey | VWMXOIXHIGWSIN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 175769344 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175769344?
The IUPAC name of CID 175769344 (CID 175769344) is not available.
What is the SMILES notation for CID 175769344?
The canonical SMILES for CID 175769344 is Cn1nc2ccc(S)c(Cl)c2c1C#N.[Na].
What is the InChIKey of CID 175769344?
The InChIKey is VWMXOIXHIGWSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN3S.Na/c1-13-6(4-11)8-5(12-13)2-3-7(14)9(8)10;/h2-3,14H,1H3;.
What are the key properties of CID 175769344?
CID 175769344 has a molecular weight of 246.68 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175769344 is sourced from PubChem (CID 175769344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).