C21H25F3N8O3S — CID 175769459
2-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethyl]phenyl]-1,3-thiazole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175769459) has the molecular formula C21H25F3N8O3S and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethyl]phenyl]-1,3-thiazole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethyl]phenyl]-1,3-thiazole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175769459 |
| Molecular Formula | C21H25F3N8O3S |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-(1-carbamimidoyl-3,6-dihydro-2H-pyridin-4-yl)-N-[4-[2-(diaminomethylideneamino)ethyl]phenyl]-1,3-thiazole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N1CC=C(c2ncc(C(=O)Nc3ccc(CCN=C(N)N)cc3)s2)CC1 |
| InChI | InChI=1S/C19H24N8OS.C2HF3O2/c20-18(21)24-8-5-12-1-3-14(4-2-12)26-16(28)15-11-25-17(29-15)13-6-9-27(10-7-13)19(22)23;3-2(4,5)1(6)7/h1-4,6,11H,5,7-10H2,(H3,22,23)(H,26,28)(H4,20,21,24);(H,6,7) |
| InChIKey | QXELRNGRFQCOMP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 196.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|