About 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one
3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one (PubChem CID 175769647) has the molecular formula C11H9BrO
and a molecular weight of 237.10 g/mol. Its IUPAC name is 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one.
Molecular Properties
| Compound Name | 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one |
| PubChem CID | 175769647 |
| Molecular Formula | C11H9BrO |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one |
| SMILES | O=C1c2ccccc2C(Br)C12CC2 |
| InChI | InChI=1S/C11H9BrO/c12-9-7-3-1-2-4-8(7)10(13)11(9)5-6-11/h1-4,9H,5-6H2 |
| InChIKey | OOTVVWKAUYLJDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one?
The IUPAC name of 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one (CID 175769647) is 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one.
What is the SMILES notation for 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one?
The canonical SMILES for 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one is O=C1c2ccccc2C(Br)C12CC2.
What is the InChIKey of 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one?
The InChIKey is OOTVVWKAUYLJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO/c12-9-7-3-1-2-4-8(7)10(13)11(9)5-6-11/h1-4,9H,5-6H2.
What are the key properties of 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one?
3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one has a molecular weight of 237.10 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromospiro[3H-indene-2,1'-cyclopropane]-1-one is sourced from PubChem (CID 175769647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).