C24H28F3N3O — CID 175770457
3,3-difluoro-N-[2-[4-fluoro-2-methyl-3-(3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-3-yl)phenoxy]ethyl]propan-1-amine (PubChem CID 175770457) has the molecular formula C24H28F3N3O and a molecular weight of 431.50 g/mol. Its IUPAC name is 3,3-difluoro-N-[2-[4-fluoro-2-methyl-3-(3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-3-yl)phenoxy]ethyl]propan-1-amine.
| Compound Name | 3,3-difluoro-N-[2-[4-fluoro-2-methyl-3-(3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-3-yl)phenoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 175770457 |
| Molecular Formula | C24H28F3N3O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3,3-difluoro-N-[2-[4-fluoro-2-methyl-3-(3-methyl-1,2,4,9-tetrahydropyrido[3,4-b]indol-3-yl)phenoxy]ethyl]propan-1-amine |
| SMILES | Cc1c(OCCNCCC(F)F)ccc(F)c1C1(C)Cc2c([nH]c3ccccc23)CN1 |
| InChI | InChI=1S/C24H28F3N3O/c1-15-21(31-12-11-28-10-9-22(26)27)8-7-18(25)23(15)24(2)13-17-16-5-3-4-6-19(16)30-20(17)14-29-24/h3-8,22,28-30H,9-14H2,1-2H3 |
| InChIKey | PEEYCZAUIPPKRQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|