C15H14F3N5O4 — CID 175770507
2-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 175770507) has the molecular formula C15H14F3N5O4 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175770507 |
| Molecular Formula | C15H14F3N5O4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[6-amino-5-[(2-hydroxyphenyl)diazenyl]-2-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)Cc1ccc(/N=N/c2ccccc2O)c(N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13N5O2.C2HF3O2/c14-12(20)7-8-5-6-10(13(15)16-8)18-17-9-3-1-2-4-11(9)19;3-2(4,5)1(6)7/h1-6,19H,7H2,(H2,14,20)(H2,15,16);(H,6,7)/b18-17+; |
| InChIKey | KDSLALJIDAEDCL-ZAGWXBKKSA-N |
| XLogP | 2.45 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|