C20H22O8S — CID 175770519
6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-2-yl]methyl]cyclohex-4-ene-1,2,3-trione (PubChem CID 175770519) has the molecular formula C20H22O8S and a molecular weight of 422.46 g/mol. Its IUPAC name is 6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-2-yl]methyl]cyclohex-4-ene-1,2,3-trione.
| Compound Name | 6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-2-yl]methyl]cyclohex-4-ene-1,2,3-trione |
|---|---|
| PubChem CID | 175770519 |
| Molecular Formula | C20H22O8S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-2-yl]methyl]cyclohex-4-ene-1,2,3-trione |
| SMILES | Cc1ccc(S[C@]2(CC3C=CC(=O)C(=O)C3=O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H22O8S/c1-10-2-5-12(6-3-10)29-20(8-11-4-7-13(22)16(24)15(11)23)19(27)18(26)17(25)14(9-21)28-20/h2-7,11,14,17-19,21,25-27H,8-9H2,1H3/t11?,14-,17+,18+,19-,20+/m1/s1 |
| InChIKey | SCRCVIRWQXGTDV-XKNIDTTGSA-N |
| XLogP | -0.46 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|