About 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate
2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate (PubChem CID 175770765) has the molecular formula C14H28O6
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate.
Molecular Properties
| Compound Name | 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate |
| PubChem CID | 175770765 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate |
| SMILES | CCCC(C)(OC)C(=O)O.CCCOC(=O)C(C)OC |
| InChI | InChI=1S/2C7H14O3/c1-4-5-7(2,10-3)6(8)9;1-4-5-10-7(8)6(2)9-3/h4-5H2,1-3H3,(H,8,9);6H,4-5H2,1-3H3 |
| InChIKey | OLFFDOFKPCHOQU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate?
The IUPAC name of 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate (CID 175770765) is 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate.
What is the SMILES notation for 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate?
The canonical SMILES for 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate is CCCC(C)(OC)C(=O)O.CCCOC(=O)C(C)OC.
What is the InChIKey of 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate?
The InChIKey is OLFFDOFKPCHOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O3/c1-4-5-7(2,10-3)6(8)9;1-4-5-10-7(8)6(2)9-3/h4-5H2,1-3H3,(H,8,9);6H,4-5H2,1-3H3.
What are the key properties of 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate?
2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate has a molecular weight of 292.37 g/mol, XLogP of 2.25, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-methylpentanoic acid;propyl 2-methoxypropanoate is sourced from PubChem (CID 175770765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).