About 8-pentoxy-3,7-dihydropurine-2,6-dione
8-pentoxy-3,7-dihydropurine-2,6-dione (PubChem CID 175770858) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is 8-pentoxy-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-pentoxy-3,7-dihydropurine-2,6-dione |
| PubChem CID | 175770858 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 8-pentoxy-3,7-dihydropurine-2,6-dione |
| SMILES | CCCCCOc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H14N4O3/c1-2-3-4-5-17-10-11-6-7(13-10)12-9(16)14-8(6)15/h2-5H2,1H3,(H3,11,12,13,14,15,16) |
| InChIKey | HUYNVCSTVDRHBN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-pentoxy-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pentoxy-3,7-dihydropurine-2,6-dione?
The IUPAC name of 8-pentoxy-3,7-dihydropurine-2,6-dione (CID 175770858) is 8-pentoxy-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 8-pentoxy-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 8-pentoxy-3,7-dihydropurine-2,6-dione is CCCCCOc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1.
What is the InChIKey of 8-pentoxy-3,7-dihydropurine-2,6-dione?
The InChIKey is HUYNVCSTVDRHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O3/c1-2-3-4-5-17-10-11-6-7(13-10)12-9(16)14-8(6)15/h2-5H2,1H3,(H3,11,12,13,14,15,16).
What are the key properties of 8-pentoxy-3,7-dihydropurine-2,6-dione?
8-pentoxy-3,7-dihydropurine-2,6-dione has a molecular weight of 238.25 g/mol, XLogP of 0.51, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pentoxy-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 175770858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).