About 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide
3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 175771449) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 175771449 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | CC1CCC(n2c(=O)[nH]cc(C(N)=O)c2=O)CC1 |
| InChI | InChI=1S/C12H17N3O3/c1-7-2-4-8(5-3-7)15-11(17)9(10(13)16)6-14-12(15)18/h6-8H,2-5H2,1H3,(H2,13,16)(H,14,18) |
| InChIKey | GUHIQTIOXFWQGC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (CID 175771449) is 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is CC1CCC(n2c(=O)[nH]cc(C(N)=O)c2=O)CC1.
What is the InChIKey of 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The InChIKey is GUHIQTIOXFWQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-7-2-4-8(5-3-7)15-11(17)9(10(13)16)6-14-12(15)18/h6-8H,2-5H2,1H3,(H2,13,16)(H,14,18).
What are the key properties of 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide has a molecular weight of 251.29 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylcyclohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 175771449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).