C19H25F9N2O6 — CID 175771704
prop-2-enyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175771704) has the molecular formula C19H25F9N2O6 and a molecular weight of 548.40 g/mol. Its IUPAC name is prop-2-enyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | prop-2-enyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175771704 |
| Molecular Formula | C19H25F9N2O6 |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | prop-2-enyl (3S)-4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-fluoro-2,2-dimethylbutanoate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCOC(=O)C(C)(C)[C@H](F)CN1CC[C@@H]2NCC(F)(F)[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O2.2C2HF3O2/c1-4-7-22-13(21)14(2,3)11(16)8-20-6-5-10-12(20)15(17,18)9-19-10;2*3-2(4,5)1(6)7/h4,10-12,19H,1,5-9H2,2-3H3;2*(H,6,7)/t10-,11+,12+;;/m0../s1 |
| InChIKey | KBFIKQXVNRYDIH-MHIKFBLOSA-N |
| XLogP | 3.03 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|