About 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine
5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine (PubChem CID 175772412) has the molecular formula C15H18F2N4O
and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine.
Molecular Properties
| Compound Name | 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine |
| PubChem CID | 175772412 |
| Molecular Formula | C15H18F2N4O |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine |
| SMILES | CCN1CCC(Oc2cccc3ncnc(N)c23)C(F)(F)C1 |
| InChI | InChI=1S/C15H18F2N4O/c1-2-21-7-6-12(15(16,17)8-21)22-11-5-3-4-10-13(11)14(18)20-9-19-10/h3-5,9,12H,2,6-8H2,1H3,(H2,18,19,20) |
| InChIKey | JUAWGDPTENIROM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine?
The IUPAC name of 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine (CID 175772412) is 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine.
What is the SMILES notation for 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine?
The canonical SMILES for 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine is CCN1CCC(Oc2cccc3ncnc(N)c23)C(F)(F)C1.
What is the InChIKey of 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine?
The InChIKey is JUAWGDPTENIROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N4O/c1-2-21-7-6-12(15(16,17)8-21)22-11-5-3-4-10-13(11)14(18)20-9-19-10/h3-5,9,12H,2,6-8H2,1H3,(H2,18,19,20).
What are the key properties of 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine?
5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine has a molecular weight of 308.33 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethyl-3,3-difluoropiperidin-4-yl)oxyquinazolin-4-amine is sourced from PubChem (CID 175772412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).