About 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol
6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol (PubChem CID 175772638) has the molecular formula C24H20ClFN2O
and a molecular weight of 406.89 g/mol. Its IUPAC name is 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol.
Molecular Properties
| Compound Name | 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol |
| PubChem CID | 175772638 |
| Molecular Formula | C24H20ClFN2O |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol |
| SMILES | CCc1c(-c2ccccc2)nn(Cc2ccc(Cl)c(O)c2F)c1-c1ccccc1 |
| InChI | InChI=1S/C24H20ClFN2O/c1-2-19-22(16-9-5-3-6-10-16)27-28(23(19)17-11-7-4-8-12-17)15-18-13-14-20(25)24(29)21(18)26/h3-14,29H,2,15H2,1H3 |
| InChIKey | FPKFPIGGBYVHCI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol?
The IUPAC name of 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol (CID 175772638) is 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol.
What is the SMILES notation for 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol?
The canonical SMILES for 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol is CCc1c(-c2ccccc2)nn(Cc2ccc(Cl)c(O)c2F)c1-c1ccccc1.
What is the InChIKey of 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol?
The InChIKey is FPKFPIGGBYVHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClFN2O/c1-2-19-22(16-9-5-3-6-10-16)27-28(23(19)17-11-7-4-8-12-17)15-18-13-14-20(25)24(29)21(18)26/h3-14,29H,2,15H2,1H3.
What are the key properties of 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol?
6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol has a molecular weight of 406.89 g/mol, XLogP of 6.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(4-ethyl-3,5-diphenylpyrazol-1-yl)methyl]-2-fluorophenol is sourced from PubChem (CID 175772638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).