C24H17F5N4O3 — CID 175772998
[(5R)-2-[4-[[3-(3,5-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluoroanilino]-5-fluoro-4,6-dihydro-1,3-oxazin-5-yl]methanol (PubChem CID 175772998) has the molecular formula C24H17F5N4O3 and a molecular weight of 504.42 g/mol. Its IUPAC name is [(5R)-2-[4-[[3-(3,5-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluoroanilino]-5-fluoro-4,6-dihydro-1,3-oxazin-5-yl]methanol.
| Compound Name | [(5R)-2-[4-[[3-(3,5-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluoroanilino]-5-fluoro-4,6-dihydro-1,3-oxazin-5-yl]methanol |
|---|---|
| PubChem CID | 175772998 |
| Molecular Formula | C24H17F5N4O3 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [(5R)-2-[4-[[3-(3,5-difluorophenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]-3,5-difluoroanilino]-5-fluoro-4,6-dihydro-1,3-oxazin-5-yl]methanol |
| SMILES | OC[C@]1(F)CN=C(Nc2cc(F)c(Oc3ccnc4[nH]cc(-c5cc(F)cc(F)c5)c34)c(F)c2)OC1 |
| InChI | InChI=1S/C24H17F5N4O3/c25-13-3-12(4-14(26)5-13)16-8-31-22-20(16)19(1-2-30-22)36-21-17(27)6-15(7-18(21)28)33-23-32-9-24(29,10-34)11-35-23/h1-8,34H,9-11H2,(H,30,31)(H,32,33)/t24-/m1/s1 |
| InChIKey | FJNAYAKEWLOYKT-XMMPIXPASA-N |
| XLogP | 5.08 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |