About 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide
5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide (PubChem CID 175773475) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide |
| PubChem CID | 175773475 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide |
| SMILES | CNC(=O)N1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C10H11FN2O/c1-12-10(14)13-5-7-2-3-9(11)4-8(7)6-13/h2-4H,5-6H2,1H3,(H,12,14) |
| InChIKey | XYNXRVLQCVEJEZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide?
The IUPAC name of 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide (CID 175773475) is 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide.
What is the SMILES notation for 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide?
The canonical SMILES for 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide is CNC(=O)N1Cc2ccc(F)cc2C1.
What is the InChIKey of 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide?
The InChIKey is XYNXRVLQCVEJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O/c1-12-10(14)13-5-7-2-3-9(11)4-8(7)6-13/h2-4H,5-6H2,1H3,(H,12,14).
What are the key properties of 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide?
5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide has a molecular weight of 194.21 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-methyl-1,3-dihydroisoindole-2-carboxamide is sourced from PubChem (CID 175773475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).