C16H19FN2O2 — CID 175773534
(1R)-8-fluoro-1-(3-hydroxypropylamino)-2,3,4,5-tetrahydro-1H-phenanthridin-6-one (PubChem CID 175773534) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is (1R)-8-fluoro-1-(3-hydroxypropylamino)-2,3,4,5-tetrahydro-1H-phenanthridin-6-one.
| Compound Name | (1R)-8-fluoro-1-(3-hydroxypropylamino)-2,3,4,5-tetrahydro-1H-phenanthridin-6-one |
|---|---|
| PubChem CID | 175773534 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (1R)-8-fluoro-1-(3-hydroxypropylamino)-2,3,4,5-tetrahydro-1H-phenanthridin-6-one |
| SMILES | O=c1[nH]c2c(c3ccc(F)cc13)[C@H](NCCCO)CCC2 |
| InChI | InChI=1S/C16H19FN2O2/c17-10-5-6-11-12(9-10)16(21)19-14-4-1-3-13(15(11)14)18-7-2-8-20/h5-6,9,13,18,20H,1-4,7-8H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | HTMJSJBEHKUECV-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|