C11H8F3N3O — CID 175774324
N-(2,2,2-trifluoroethyl)quinazoline-8-carboxamide (PubChem CID 175774324) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)quinazoline-8-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 175774324 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)quinazoline-8-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc2cncnc12 |
| InChI | InChI=1S/C11H8F3N3O/c12-11(13,14)5-16-10(18)8-3-1-2-7-4-15-6-17-9(7)8/h1-4,6H,5H2,(H,16,18) |
| InChIKey | WAPOTEQDXDCYDM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |