About ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate
ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate (PubChem CID 175774568) has the molecular formula C24H26Cl4N2O4
and a molecular weight of 548.29 g/mol. Its IUPAC name is ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate |
| PubChem CID | 175774568 |
| Molecular Formula | C24H26Cl4N2O4 |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\NC)c1ccc(Cl)c(Cl)c1.CCOC(=O)/C=C(\NC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/2C12H13Cl2NO2/c2*1-3-17-12(16)7-11(15-2)8-4-5-9(13)10(14)6-8/h2*4-7,15H,3H2,1-2H3/b2*11-7- |
| InChIKey | WHHXDXCKRXYYBX-PKUBBLDMSA-N |
| XLogP | 6.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate?
The IUPAC name of ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate (CID 175774568) is ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate.
What is the SMILES notation for ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate?
The canonical SMILES for ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate is CCOC(=O)/C=C(\NC)c1ccc(Cl)c(Cl)c1.CCOC(=O)/C=C(\NC)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate?
The InChIKey is WHHXDXCKRXYYBX-PKUBBLDMSA-N. The full InChI is InChI=1S/2C12H13Cl2NO2/c2*1-3-17-12(16)7-11(15-2)8-4-5-9(13)10(14)6-8/h2*4-7,15H,3H2,1-2H3/b2*11-7-.
What are the key properties of ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate?
ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate has a molecular weight of 548.29 g/mol, XLogP of 6.23, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enoate is sourced from PubChem (CID 175774568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).