About 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline]
1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] (PubChem CID 175774868) has the molecular formula C20H18ClFN6O
and a molecular weight of 412.86 g/mol. Its IUPAC name is 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline].
Molecular Properties
| Compound Name | 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] |
| PubChem CID | 175774868 |
| Molecular Formula | C20H18ClFN6O |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] |
| SMILES | Fc1ccc(Oc2cccc3c2C2(CCCCC2)N=CN3Cl)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C20H18ClFN6O/c21-28-12-23-20(9-2-1-3-10-20)18-15(28)5-4-6-17(18)29-16-8-7-13(22)11-14(16)19-24-26-27-25-19/h4-8,11-12H,1-3,9-10H2,(H,24,25,26,27) |
| InChIKey | XHWYAGHFPFWMQC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline]?
The IUPAC name of 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] (CID 175774868) is 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline].
What is the SMILES notation for 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline]?
The canonical SMILES for 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] is Fc1ccc(Oc2cccc3c2C2(CCCCC2)N=CN3Cl)c(-c2nn[nH]n2)c1.
What is the InChIKey of 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline]?
The InChIKey is XHWYAGHFPFWMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClFN6O/c21-28-12-23-20(9-2-1-3-10-20)18-15(28)5-4-6-17(18)29-16-8-7-13(22)11-14(16)19-24-26-27-25-19/h4-8,11-12H,1-3,9-10H2,(H,24,25,26,27).
What are the key properties of 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline]?
1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] has a molecular weight of 412.86 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-chloro-5'-[4-fluoro-2-(2H-tetrazol-5-yl)phenoxy]spiro[cyclohexane-1,4'-quinazoline] is sourced from PubChem (CID 175774868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).