C13H26BF3N6O8S — CID 175775185
(3S,4R)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 175775185) has the molecular formula C13H26BF3N6O8S and a molecular weight of 494.26 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,4R)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175775185 |
| Molecular Formula | C13H26BF3N6O8S |
| Molecular Weight | 494.26 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (3S,4R)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCNS(=O)(=O)N1C[C@@H](CCCB(O)O)[C@@](N)(C(=O)O)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H25BN6O6S.C2HF3O2/c13-10(14)16-4-5-17-25(23,24)18-6-8(2-1-3-12(21)22)11(15,7-18)9(19)20;3-2(4,5)1(6)7/h8,17,21-22H,1-7,15H2,(H,19,20)(H4,13,14,16);(H,6,7)/t8-,11-;/m1./s1 |
| InChIKey | TVIORZDYOXRLRD-JHQAJZDGSA-N |
| XLogP | -3.31 |
| TPSA | 254.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.26 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|