C31H34N6O5S — CID 175775333
[(1R)-1-phenylethyl] (3S,4R)-3-azido-1-(dibenzylcarbamoylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 175775333) has the molecular formula C31H34N6O5S and a molecular weight of 602.72 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (3S,4R)-3-azido-1-(dibenzylcarbamoylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | [(1R)-1-phenylethyl] (3S,4R)-3-azido-1-(dibenzylcarbamoylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 175775333 |
| Molecular Formula | C31H34N6O5S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [(1R)-1-phenylethyl] (3S,4R)-3-azido-1-(dibenzylcarbamoylsulfamoyl)-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@@H]1CN(S(=O)(=O)NC(=O)N(Cc2ccccc2)Cc2ccccc2)C[C@]1(N=[N+]=[N-])C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C31H34N6O5S/c1-3-13-28-22-37(23-31(28,34-35-32)29(38)42-24(2)27-18-11-6-12-19-27)43(40,41)33-30(39)36(20-25-14-7-4-8-15-25)21-26-16-9-5-10-17-26/h3-12,14-19,24,28H,1,13,20-23H2,2H3,(H,33,39)/t24-,28-,31-/m1/s1 |
| InChIKey | OBAUBAHNPIBZSK-HVOSOHGQSA-N |
| XLogP | 5.50 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|