About azane;4-phenylpyridine
azane;4-phenylpyridine (PubChem CID 175775455) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is azane;4-phenylpyridine.
Molecular Properties
| Compound Name | azane;4-phenylpyridine |
| PubChem CID | 175775455 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | azane;4-phenylpyridine |
| SMILES | N.c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C11H9N.H3N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-9H;1H3 |
| InChIKey | OJPLLCNSRXIAOK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;4-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-phenylpyridine?
The IUPAC name of azane;4-phenylpyridine (CID 175775455) is azane;4-phenylpyridine.
What is the SMILES notation for azane;4-phenylpyridine?
The canonical SMILES for azane;4-phenylpyridine is N.c1ccc(-c2ccncc2)cc1.
What is the InChIKey of azane;4-phenylpyridine?
The InChIKey is OJPLLCNSRXIAOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N.H3N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-9H;1H3.
What are the key properties of azane;4-phenylpyridine?
azane;4-phenylpyridine has a molecular weight of 172.23 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-phenylpyridine is sourced from PubChem (CID 175775455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).