C26H44O4 — CID 175775542
[(2E)-3,7-dimethylocta-2,6-dienyl] propanoate;(4E)-2,5,9-trimethyldeca-4,8-dienoic acid (PubChem CID 175775542) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] propanoate;(4E)-2,5,9-trimethyldeca-4,8-dienoic acid.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] propanoate;(4E)-2,5,9-trimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 175775542 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] propanoate;(4E)-2,5,9-trimethyldeca-4,8-dienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC(C)C(=O)O.CCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/2C13H22O2/c1-10(2)6-5-7-11(3)8-9-12(4)13(14)15;1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h6,8,12H,5,7,9H2,1-4H3,(H,14,15);7,9H,5-6,8,10H2,1-4H3/b11-8+;12-9+ |
| InChIKey | VFSABWZPSGNGDJ-FBDYMYQUSA-N |
| XLogP | 7.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|