About [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol
[5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol (PubChem CID 175775605) has the molecular formula C11H11F2NO
and a molecular weight of 211.21 g/mol. Its IUPAC name is [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol |
| PubChem CID | 175775605 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol |
| SMILES | OCC1CCC(c2cc(F)ccc2F)=N1 |
| InChI | InChI=1S/C11H11F2NO/c12-7-1-3-10(13)9(5-7)11-4-2-8(6-15)14-11/h1,3,5,8,15H,2,4,6H2 |
| InChIKey | PGJNQDCGIGAKHH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol?
The IUPAC name of [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol (CID 175775605) is [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol.
What is the SMILES notation for [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol?
The canonical SMILES for [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol is OCC1CCC(c2cc(F)ccc2F)=N1.
What is the InChIKey of [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol?
The InChIKey is PGJNQDCGIGAKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO/c12-7-1-3-10(13)9(5-7)11-4-2-8(6-15)14-11/h1,3,5,8,15H,2,4,6H2.
What are the key properties of [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol?
[5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol has a molecular weight of 211.21 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]methanol is sourced from PubChem (CID 175775605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).