C10H19FN2O2 — CID 175776423
butyl (3R,5S)-3-amino-5-fluoropiperidine-1-carboxylate (PubChem CID 175776423) has the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. Its IUPAC name is butyl (3R,5S)-3-amino-5-fluoropiperidine-1-carboxylate.
| Compound Name | butyl (3R,5S)-3-amino-5-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175776423 |
| Molecular Formula | C10H19FN2O2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | butyl (3R,5S)-3-amino-5-fluoropiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](N)C[C@H](F)C1 |
| InChI | InChI=1S/C10H19FN2O2/c1-2-3-4-15-10(14)13-6-8(11)5-9(12)7-13/h8-9H,2-7,12H2,1H3/t8-,9+/m0/s1 |
| InChIKey | OQVHRGSBFYEVOW-DTWKUNHWSA-N |
| XLogP | 1.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|