C28H32ClN7O5S — CID 175776723
2-[2-amino-1-(3-chlorophenyl)ethyl]-1-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]imidazole-4-carboxamide;benzenesulfonic acid (PubChem CID 175776723) has the molecular formula C28H32ClN7O5S and a molecular weight of 614.13 g/mol. Its IUPAC name is 2-[2-amino-1-(3-chlorophenyl)ethyl]-1-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]imidazole-4-carboxamide;benzenesulfonic acid.
| Compound Name | 2-[2-amino-1-(3-chlorophenyl)ethyl]-1-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]imidazole-4-carboxamide;benzenesulfonic acid |
|---|---|
| PubChem CID | 175776723 |
| Molecular Formula | C28H32ClN7O5S |
| Molecular Weight | 614.13 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 2-[2-amino-1-(3-chlorophenyl)ethyl]-1-[5-methyl-2-(oxan-4-ylamino)pyrimidin-4-yl]imidazole-4-carboxamide;benzenesulfonic acid |
| SMILES | Cc1cnc(NC2CCOCC2)nc1-n1cc(C(N)=O)nc1C(CN)c1cccc(Cl)c1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C22H26ClN7O2.C6H6O3S/c1-13-11-26-22(27-16-5-7-32-8-6-16)29-20(13)30-12-18(19(25)31)28-21(30)17(10-24)14-3-2-4-15(23)9-14;7-10(8,9)6-4-2-1-3-5-6/h2-4,9,11-12,16-17H,5-8,10,24H2,1H3,(H2,25,31)(H,26,27,29);1-5H,(H,7,8,9) |
| InChIKey | ODOVTUIREZAMQF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 188.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|