C18H17N3 — CID 175776950
1-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 175776950) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 1-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 175776950 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Nc1c2c(nc3ccccc13)CCCC2c1cccnc1 |
| InChI | InChI=1S/C18H17N3/c19-18-14-6-1-2-8-15(14)21-16-9-3-7-13(17(16)18)12-5-4-10-20-11-12/h1-2,4-6,8,10-11,13H,3,7,9H2,(H2,19,21) |
| InChIKey | WLXBVPPRIFPJDM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |