C9H5N3 — CID 175777118
5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene (PubChem CID 175777118) has the molecular formula C9H5N3 and a molecular weight of 155.16 g/mol. Its IUPAC name is 5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene.
| Compound Name | 5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 175777118 |
| Molecular Formula | C9H5N3 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 5,7,10-triazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
| SMILES | C1=Cc2c3c(ncc2=N1)=NC=C3 |
| InChI | InChI=1S/C9H5N3/c1-3-10-8-5-12-9-7(6(1)8)2-4-11-9/h1-5H |
| InChIKey | DUJJFYUCXSSLHD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |