About 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole
2,4-dimethyl-4H-chromeno[4,3-c]pyrazole (PubChem CID 175777136) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole |
| PubChem CID | 175777136 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole |
| SMILES | CC1Oc2ccccc2-c2nn(C)cc21 |
| InChI | InChI=1S/C12H12N2O/c1-8-10-7-14(2)13-12(10)9-5-3-4-6-11(9)15-8/h3-8H,1-2H3 |
| InChIKey | GISVPJHLDSMQFK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole?
The IUPAC name of 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole (CID 175777136) is 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole.
What is the SMILES notation for 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole?
The canonical SMILES for 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole is CC1Oc2ccccc2-c2nn(C)cc21.
What is the InChIKey of 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole?
The InChIKey is GISVPJHLDSMQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-8-10-7-14(2)13-12(10)9-5-3-4-6-11(9)15-8/h3-8H,1-2H3.
What are the key properties of 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole?
2,4-dimethyl-4H-chromeno[4,3-c]pyrazole has a molecular weight of 200.24 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-4H-chromeno[4,3-c]pyrazole is sourced from PubChem (CID 175777136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).