C14H18N2O4S — CID 175777335
3-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]cyclobutane-1-carboxylic acid (PubChem CID 175777335) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 175777335 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]cyclobutane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NN=C2CC(C(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-8-4-9(2)13(10(3)5-8)21(19,20)16-15-12-6-11(7-12)14(17)18/h4-5,11,16H,6-7H2,1-3H3,(H,17,18)/b15-12- |
| InChIKey | TYUGJOMSXSJEQI-QINSGFPZSA-N |
| XLogP | 1.74 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|