C34H46BFN2O4 — CID 175777682
N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-5-fluoro-2-methylbenzamide (PubChem CID 175777682) has the molecular formula C34H46BFN2O4 and a molecular weight of 576.56 g/mol. Its IUPAC name is N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-5-fluoro-2-methylbenzamide.
| Compound Name | N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 175777682 |
| Molecular Formula | C34H46BFN2O4 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)NCC1CC(Cc2ccccc2)ON1[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C34H46BFN2O4/c1-21(2)14-31(35-40-30-17-24-16-29(33(24,4)5)34(30,6)42-35)38-26(19-27(41-38)15-23-10-8-7-9-11-23)20-37-32(39)28-18-25(36)13-12-22(28)3/h7-13,18,21,24,26-27,29-31H,14-17,19-20H2,1-6H3,(H,37,39)/t24-,26?,27?,29-,30+,31-,34-/m0/s1 |
| InChIKey | OHGGEANYTKIKTQ-JHNAWSCBSA-N |
| XLogP | 6.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|