C35H46BN3O4 — CID 175777807
N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-1H-indole-4-carboxamide (PubChem CID 175777807) has the molecular formula C35H46BN3O4 and a molecular weight of 583.58 g/mol. Its IUPAC name is N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-1H-indole-4-carboxamide.
| Compound Name | N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 175777807 |
| Molecular Formula | C35H46BN3O4 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | N-[[5-benzyl-2-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-1,2-oxazolidin-3-yl]methyl]-1H-indole-4-carboxamide |
| SMILES | CC(C)C[C@@H](B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)N1OC(Cc2ccccc2)CC1CNC(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C35H46BN3O4/c1-22(2)16-32(36-41-31-19-24-18-30(34(24,3)4)35(31,5)43-36)39-25(20-26(42-39)17-23-10-7-6-8-11-23)21-38-33(40)28-12-9-13-29-27(28)14-15-37-29/h6-15,22,24-26,30-32,37H,16-21H2,1-5H3,(H,38,40)/t24-,25?,26?,30-,31+,32-,35-/m0/s1 |
| InChIKey | INDZJEDCUKEWEK-ATBWGKJVSA-N |
| XLogP | 6.20 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|