About 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one
1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one (PubChem CID 175778023) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one |
| PubChem CID | 175778023 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one |
| SMILES | CCN1C(=O)OCc2cnccc21 |
| InChI | InChI=1S/C9H10N2O2/c1-2-11-8-3-4-10-5-7(8)6-13-9(11)12/h3-5H,2,6H2,1H3 |
| InChIKey | DZVSBBDLQMIFOF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one?
The IUPAC name of 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one (CID 175778023) is 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one.
What is the SMILES notation for 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one?
The canonical SMILES for 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one is CCN1C(=O)OCc2cnccc21.
What is the InChIKey of 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one?
The InChIKey is DZVSBBDLQMIFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-2-11-8-3-4-10-5-7(8)6-13-9(11)12/h3-5H,2,6H2,1H3.
What are the key properties of 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one?
1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one has a molecular weight of 178.19 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4H-pyrido[4,3-d][1,3]oxazin-2-one is sourced from PubChem (CID 175778023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).