C7H13NS — CID 175778097
1,1,1,1,2,2,3,3,3a-nonadeuterio-4H-thieno[2,3-c]pyridine (PubChem CID 175778097) has the molecular formula C7H13NS and a molecular weight of 152.31 g/mol. Its IUPAC name is 1,1,1,1,2,2,3,3,3a-nonadeuterio-4H-thieno[2,3-c]pyridine.
| Compound Name | 1,1,1,1,2,2,3,3,3a-nonadeuterio-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 175778097 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,1,1,1,2,2,3,3,3a-nonadeuterio-4H-thieno[2,3-c]pyridine |
| SMILES | [2H]C12CC=NC=C1S([2H])([2H])([2H])([2H])C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C7H13NS/c1-3-8-5-7-6(1)2-4-9-7/h3,5-6H,1-2,4H2,9H4/i2D2,4D2,6D,9D4 |
| InChIKey | UESFUJQIYYCGNA-CLYLKDRSSA-N |
| XLogP | 0.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |