C10H13Hf- — CID 175778554
4,6-dimethyl-2,3,4,5-tetrahydro-1H-pentalen-5-ide;hafnium (PubChem CID 175778554) has the molecular formula C10H13Hf- and a molecular weight of 311.70 g/mol. Its IUPAC name is 4,6-dimethyl-2,3,4,5-tetrahydro-1H-pentalen-5-ide;hafnium.
| Compound Name | 4,6-dimethyl-2,3,4,5-tetrahydro-1H-pentalen-5-ide;hafnium |
|---|---|
| PubChem CID | 175778554 |
| Molecular Formula | C10H13Hf- |
| Molecular Weight | 311.70 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4,6-dimethyl-2,3,4,5-tetrahydro-1H-pentalen-5-ide;hafnium |
| SMILES | CC1=[C-]C(C)C2=C1CCC2.[Hf] |
| InChI | InChI=1S/C10H13.Hf/c1-7-6-8(2)10-5-3-4-9(7)10;/h7H,3-5H2,1-2H3;/q-1; |
| InChIKey | LFUMQDRWCGIQPY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|