C37H36N4O8 — CID 175778748
2-[5'-(6-carbamoyl-2-methyl-3-nitrophenyl)-6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-5-yl]-3-methyl-4-nitrobenzamide (PubChem CID 175778748) has the molecular formula C37H36N4O8 and a molecular weight of 664.72 g/mol. Its IUPAC name is 2-[5'-(6-carbamoyl-2-methyl-3-nitrophenyl)-6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-5-yl]-3-methyl-4-nitrobenzamide.
| Compound Name | 2-[5'-(6-carbamoyl-2-methyl-3-nitrophenyl)-6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-5-yl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 175778748 |
| Molecular Formula | C37H36N4O8 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | 2-[5'-(6-carbamoyl-2-methyl-3-nitrophenyl)-6,6'-dihydroxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-5-yl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])ccc(C(N)=O)c1-c1cc2c(cc1O)C1(CC2(C)C)CC(C)(C)c2cc(-c3c(C(N)=O)ccc([N+](=O)[O-])c3C)c(O)cc21 |
| InChI | InChI=1S/C37H36N4O8/c1-17-27(40(46)47)9-7-19(33(38)44)31(17)21-11-23-25(13-29(21)42)37(15-35(23,3)4)16-36(5,6)24-12-22(30(43)14-26(24)37)32-18(2)28(41(48)49)10-8-20(32)34(39)45/h7-14,42-43H,15-16H2,1-6H3,(H2,38,44)(H2,39,45) |
| InChIKey | WBZLQOGOUNXBCL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 212.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|