C18H38O2 — CID 175779679
5,6-dimethyl-5-propyltridecane-4,4-diol (PubChem CID 175779679) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 5,6-dimethyl-5-propyltridecane-4,4-diol.
| Compound Name | 5,6-dimethyl-5-propyltridecane-4,4-diol |
|---|---|
| PubChem CID | 175779679 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 5,6-dimethyl-5-propyltridecane-4,4-diol |
| SMILES | CCCCCCCC(C)C(C)(CCC)C(O)(O)CCC |
| InChI | InChI=1S/C18H38O2/c1-6-9-10-11-12-13-16(4)17(5,14-7-2)18(19,20)15-8-3/h16,19-20H,6-15H2,1-5H3 |
| InChIKey | NHRCTACTLIOYIN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|