About 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one
7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 175780474) has the molecular formula C9H8F2N2OS
and a molecular weight of 230.24 g/mol. Its IUPAC name is 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one |
| PubChem CID | 175780474 |
| Molecular Formula | C9H8F2N2OS |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | O=c1cc(NCC(F)F)c2sccc2[nH]1 |
| InChI | InChI=1S/C9H8F2N2OS/c10-7(11)4-12-6-3-8(14)13-5-1-2-15-9(5)6/h1-3,7H,4H2,(H2,12,13,14) |
| InChIKey | PPLPCQRORJNETQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one?
The IUPAC name of 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one (CID 175780474) is 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one.
What is the SMILES notation for 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one?
The canonical SMILES for 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one is O=c1cc(NCC(F)F)c2sccc2[nH]1.
What is the InChIKey of 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one?
The InChIKey is PPLPCQRORJNETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2OS/c10-7(11)4-12-6-3-8(14)13-5-1-2-15-9(5)6/h1-3,7H,4H2,(H2,12,13,14).
What are the key properties of 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one?
7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one has a molecular weight of 230.24 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-difluoroethylamino)-4H-thieno[3,2-b]pyridin-5-one is sourced from PubChem (CID 175780474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).