About 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one
7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one (PubChem CID 175780524) has the molecular formula C17H16F2N2O2S
and a molecular weight of 350.39 g/mol. Its IUPAC name is 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one |
| PubChem CID | 175780524 |
| Molecular Formula | C17H16F2N2O2S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one |
| SMILES | COc1ccc(Cn2c(=O)cc(NCC(F)F)c3sccc32)cc1 |
| InChI | InChI=1S/C17H16F2N2O2S/c1-23-12-4-2-11(3-5-12)10-21-14-6-7-24-17(14)13(8-16(21)22)20-9-15(18)19/h2-8,15,20H,9-10H2,1H3 |
| InChIKey | UHZUKZISEGZTRY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one?
The IUPAC name of 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one (CID 175780524) is 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one.
What is the SMILES notation for 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one?
The canonical SMILES for 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one is COc1ccc(Cn2c(=O)cc(NCC(F)F)c3sccc32)cc1.
What is the InChIKey of 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one?
The InChIKey is UHZUKZISEGZTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2O2S/c1-23-12-4-2-11(3-5-12)10-21-14-6-7-24-17(14)13(8-16(21)22)20-9-15(18)19/h2-8,15,20H,9-10H2,1H3.
What are the key properties of 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one?
7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one has a molecular weight of 350.39 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-difluoroethylamino)-4-[(4-methoxyphenyl)methyl]thieno[3,2-b]pyridin-5-one is sourced from PubChem (CID 175780524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).