C22H32Cl2OTi — CID 175780586
3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-2,6-di(propan-2-yl)phenol;titanium(2+);dichloride (PubChem CID 175780586) has the molecular formula C22H32Cl2OTi and a molecular weight of 431.27 g/mol. Its IUPAC name is 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-2,6-di(propan-2-yl)phenol;titanium(2+);dichloride.
| Compound Name | 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-2,6-di(propan-2-yl)phenol;titanium(2+);dichloride |
|---|---|
| PubChem CID | 175780586 |
| Molecular Formula | C22H32Cl2OTi |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-2,6-di(propan-2-yl)phenol;titanium(2+);dichloride |
| SMILES | CC1=C(C)C(C)(c2ccc(C(C)C)c(O)c2C(C)C)C(C)=C1C.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C22H32O.2ClH.Ti/c1-12(2)18-10-11-19(20(13(3)4)21(18)23)22(9)16(7)14(5)15(6)17(22)8;;;/h10-13,23H,1-9H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NBOVUVMULXCJHI-UHFFFAOYSA-L |
| XLogP | 0.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |