About 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride
8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride (PubChem CID 175780838) has the molecular formula C8H8ClN3O
and a molecular weight of 197.63 g/mol. Its IUPAC name is 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride.
Molecular Properties
| Compound Name | 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| PubChem CID | 175780838 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.63 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.Cn1c(=O)ccc2cncnc21 |
| InChI | InChI=1S/C8H7N3O.ClH/c1-11-7(12)3-2-6-4-9-5-10-8(6)11;/h2-5H,1H3;1H |
| InChIKey | DTWUDUJCBLSWGT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The IUPAC name of 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride (CID 175780838) is 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride.
What is the SMILES notation for 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The canonical SMILES for 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride is Cl.Cn1c(=O)ccc2cncnc21.
What is the InChIKey of 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride?
The InChIKey is DTWUDUJCBLSWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O.ClH/c1-11-7(12)3-2-6-4-9-5-10-8(6)11;/h2-5H,1H3;1H.
What are the key properties of 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride?
8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride has a molecular weight of 197.63 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylpyrido[2,3-d]pyrimidin-7-one;hydrochloride is sourced from PubChem (CID 175780838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).