C8H5BrF3N3O3 — CID 175781284
1,4-dioxido-7-(trifluoromethoxy)-1,2,4-benzotriazine-1,4-diium;hydrobromide (PubChem CID 175781284) has the molecular formula C8H5BrF3N3O3 and a molecular weight of 328.04 g/mol. Its IUPAC name is 1,4-dioxido-7-(trifluoromethoxy)-1,2,4-benzotriazine-1,4-diium;hydrobromide.
| Compound Name | 1,4-dioxido-7-(trifluoromethoxy)-1,2,4-benzotriazine-1,4-diium;hydrobromide |
|---|---|
| PubChem CID | 175781284 |
| Molecular Formula | C8H5BrF3N3O3 |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 1,4-dioxido-7-(trifluoromethoxy)-1,2,4-benzotriazine-1,4-diium;hydrobromide |
| SMILES | Br.[O-][n+]1cn[n+]([O-])c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C8H4F3N3O3.BrH/c9-8(10,11)17-5-1-2-6-7(3-5)14(16)12-4-13(6)15;/h1-4H;1H |
| InChIKey | VWAWQQWQVPBMCM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 76.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|