C10H11F3N2O2 — CID 175781339
1-(2,2,2-trifluoroethyl)cyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 175781339) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)cyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 1-(2,2,2-trifluoroethyl)cyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175781339 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)cyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | NC(=O)C1=CC=CC(CC(F)(F)F)(C(N)=O)C1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)5-9(8(15)17)3-1-2-6(4-9)7(14)16/h1-3H,4-5H2,(H2,14,16)(H2,15,17) |
| InChIKey | IOMTWFFVAPPGEB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |