About 2-(azocin-4-yl)acetamide
2-(azocin-4-yl)acetamide (PubChem CID 175781969) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-(azocin-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(azocin-4-yl)acetamide |
| PubChem CID | 175781969 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-(azocin-4-yl)acetamide |
| SMILES | NC(=O)CC1=C/C=N\C=CC=C1 |
| InChI | InChI=1S/C9H10N2O/c10-9(12)7-8-3-1-2-5-11-6-4-8/h1-6H,7H2,(H2,10,12)/b2-1?,3-1?,5-2?,6-4?,8-3?,8-4?,11-5?,11-6- |
| InChIKey | GZNCDZZQVHCZFT-GEPLUBEQSA-N |
| XLogP | 0.94 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azocin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azocin-4-yl)acetamide?
The IUPAC name of 2-(azocin-4-yl)acetamide (CID 175781969) is 2-(azocin-4-yl)acetamide.
What is the SMILES notation for 2-(azocin-4-yl)acetamide?
The canonical SMILES for 2-(azocin-4-yl)acetamide is NC(=O)CC1=C/C=N\C=CC=C1.
What is the InChIKey of 2-(azocin-4-yl)acetamide?
The InChIKey is GZNCDZZQVHCZFT-GEPLUBEQSA-N. The full InChI is InChI=1S/C9H10N2O/c10-9(12)7-8-3-1-2-5-11-6-4-8/h1-6H,7H2,(H2,10,12)/b2-1?,3-1?,5-2?,6-4?,8-3?,8-4?,11-5?,11-6-.
What are the key properties of 2-(azocin-4-yl)acetamide?
2-(azocin-4-yl)acetamide has a molecular weight of 162.19 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azocin-4-yl)acetamide is sourced from PubChem (CID 175781969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).