C8H11NO — CID 175782062
1,3,4,6-tetrahydropyrido[2,1-c][1,4]oxazine (PubChem CID 175782062) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,3,4,6-tetrahydropyrido[2,1-c][1,4]oxazine.
| Compound Name | 1,3,4,6-tetrahydropyrido[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 175782062 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,3,4,6-tetrahydropyrido[2,1-c][1,4]oxazine |
| SMILES | C1=CCN2CCOCC2=C1 |
| InChI | InChI=1S/C8H11NO/c1-2-4-9-5-6-10-7-8(9)3-1/h1-3H,4-7H2 |
| InChIKey | DOUBACONURWQAO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |