About 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol
2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 175782068) has the molecular formula C7H9F3O4
and a molecular weight of 214.14 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol |
| PubChem CID | 175782068 |
| Molecular Formula | C7H9F3O4 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | OCC1OC=C(C(F)(F)F)C(O)C1O |
| InChI | InChI=1S/C7H9F3O4/c8-7(9,10)3-2-14-4(1-11)6(13)5(3)12/h2,4-6,11-13H,1H2 |
| InChIKey | OGIPXFQDXYALGI-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol?
The IUPAC name of 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol (CID 175782068) is 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol.
What is the SMILES notation for 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol?
The canonical SMILES for 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol is OCC1OC=C(C(F)(F)F)C(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol?
The InChIKey is OGIPXFQDXYALGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3O4/c8-7(9,10)3-2-14-4(1-11)6(13)5(3)12/h2,4-6,11-13H,1H2.
What are the key properties of 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol?
2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol has a molecular weight of 214.14 g/mol, XLogP of -0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-5-(trifluoromethyl)-3,4-dihydro-2H-pyran-3,4-diol is sourced from PubChem (CID 175782068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).