C29H20F9IO6S — CID 175782211
[4-(4,7-dimethoxynaphthalene-1-carbonyl)phenyl]-phenyliodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 175782211) has the molecular formula C29H20F9IO6S and a molecular weight of 794.43 g/mol. Its IUPAC name is [4-(4,7-dimethoxynaphthalene-1-carbonyl)phenyl]-phenyliodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [4-(4,7-dimethoxynaphthalene-1-carbonyl)phenyl]-phenyliodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 175782211 |
| Molecular Formula | C29H20F9IO6S |
| Molecular Weight | 794.43 g/mol |
| Exact Mass | 793.99 |
| IUPAC Name | [4-(4,7-dimethoxynaphthalene-1-carbonyl)phenyl]-phenyliodanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc2c(OC)ccc(C(=O)c3ccc([I+]c4ccccc4)cc3)c2c1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H20IO3.C4HF9O3S/c1-28-20-12-13-21-23(16-20)22(14-15-24(21)29-2)25(27)17-8-10-19(11-9-17)26-18-6-4-3-5-7-18;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h3-16H,1-2H3;(H,14,15,16)/q+1;/p-1 |
| InChIKey | XDOITABVSYABKS-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|