C26H31F9O7S2 — CID 175782260
1-[dimethoxy-[4-(2-propylsulfanylethyl)phenyl]methyl]-2,4-dimethoxybenzene;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 175782260) has the molecular formula C26H31F9O7S2 and a molecular weight of 690.64 g/mol. Its IUPAC name is 1-[dimethoxy-[4-(2-propylsulfanylethyl)phenyl]methyl]-2,4-dimethoxybenzene;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 1-[dimethoxy-[4-(2-propylsulfanylethyl)phenyl]methyl]-2,4-dimethoxybenzene;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 175782260 |
| Molecular Formula | C26H31F9O7S2 |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 690.14 |
| IUPAC Name | 1-[dimethoxy-[4-(2-propylsulfanylethyl)phenyl]methyl]-2,4-dimethoxybenzene;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | CCCSCCc1ccc(C(OC)(OC)c2ccc(OC)cc2OC)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H30O4S.C4HF9O3S/c1-6-14-27-15-13-17-7-9-18(10-8-17)22(25-4,26-5)20-12-11-19(23-2)16-21(20)24-3;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h7-12,16H,6,13-15H2,1-5H3;(H,14,15,16) |
| InChIKey | BWBIABCXFGGANZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|